C23H28BrN3O3S — CID 4959870
3-bromo-N-[[2-(ethylcarbamoyl)phenyl]carbamothioyl]-4-hexoxybenzamide (PubChem CID 4959870) has the molecular formula C23H28BrN3O3S and a molecular weight of 506.47 g/mol. Its IUPAC name is 3-bromo-N-[[2-(ethylcarbamoyl)phenyl]carbamothioyl]-4-hexoxybenzamide.
| Compound Name | 3-bromo-N-[[2-(ethylcarbamoyl)phenyl]carbamothioyl]-4-hexoxybenzamide |
|---|---|
| PubChem CID | 4959870 |
| Molecular Formula | C23H28BrN3O3S |
| Molecular Weight | 506.47 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | 3-bromo-N-[[2-(ethylcarbamoyl)phenyl]carbamothioyl]-4-hexoxybenzamide |
| SMILES | CCCCCCOc1ccc(C(=O)NC(=S)Nc2ccccc2C(=O)NCC)cc1Br |
| InChI | InChI=1S/C23H28BrN3O3S/c1-3-5-6-9-14-30-20-13-12-16(15-18(20)24)21(28)27-23(31)26-19-11-8-7-10-17(19)22(29)25-4-2/h7-8,10-13,15H,3-6,9,14H2,1-2H3,(H,25,29)(H2,26,27,28,31) |
| InChIKey | UKUGSUDXDJELPL-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.47 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|