C21H24BrN3O5S — CID 17086990
3-bromo-N-[[2-(3-hydroxypropylcarbamoyl)phenyl]carbamothioyl]-4-(2-methoxyethoxy)benzamide (PubChem CID 17086990) has the molecular formula C21H24BrN3O5S and a molecular weight of 510.41 g/mol. Its IUPAC name is 3-bromo-N-[[2-(3-hydroxypropylcarbamoyl)phenyl]carbamothioyl]-4-(2-methoxyethoxy)benzamide.
| Compound Name | 3-bromo-N-[[2-(3-hydroxypropylcarbamoyl)phenyl]carbamothioyl]-4-(2-methoxyethoxy)benzamide |
|---|---|
| PubChem CID | 17086990 |
| Molecular Formula | C21H24BrN3O5S |
| Molecular Weight | 510.41 g/mol |
| Exact Mass | 509.06 |
| IUPAC Name | 3-bromo-N-[[2-(3-hydroxypropylcarbamoyl)phenyl]carbamothioyl]-4-(2-methoxyethoxy)benzamide |
| SMILES | COCCOc1ccc(C(=O)NC(=S)Nc2ccccc2C(=O)NCCCO)cc1Br |
| InChI | InChI=1S/C21H24BrN3O5S/c1-29-11-12-30-18-8-7-14(13-16(18)22)19(27)25-21(31)24-17-6-3-2-5-15(17)20(28)23-9-4-10-26/h2-3,5-8,13,26H,4,9-12H2,1H3,(H,23,28)(H2,24,25,27,31) |
| InChIKey | ROVQSQQNPPMYSP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|