C24H31BrN2O3 — CID 17149395
3-bromo-N-[2-(butylcarbamoyl)phenyl]-4-hexoxybenzamide (PubChem CID 17149395) has the molecular formula C24H31BrN2O3 and a molecular weight of 475.43 g/mol. Its IUPAC name is 3-bromo-N-[2-(butylcarbamoyl)phenyl]-4-hexoxybenzamide.
| Compound Name | 3-bromo-N-[2-(butylcarbamoyl)phenyl]-4-hexoxybenzamide |
|---|---|
| PubChem CID | 17149395 |
| Molecular Formula | C24H31BrN2O3 |
| Molecular Weight | 475.43 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 3-bromo-N-[2-(butylcarbamoyl)phenyl]-4-hexoxybenzamide |
| SMILES | CCCCCCOc1ccc(C(=O)Nc2ccccc2C(=O)NCCCC)cc1Br |
| InChI | InChI=1S/C24H31BrN2O3/c1-3-5-7-10-16-30-22-14-13-18(17-20(22)25)23(28)27-21-12-9-8-11-19(21)24(29)26-15-6-4-2/h8-9,11-14,17H,3-7,10,15-16H2,1-2H3,(H,26,29)(H,27,28) |
| InChIKey | NICCDXQALVVPRW-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.43 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|