C26H27BrN2O3 — CID 4955844
3-bromo-4-butoxy-N-[2-[(3,4-dimethylphenyl)carbamoyl]phenyl]benzamide (PubChem CID 4955844) has the molecular formula C26H27BrN2O3 and a molecular weight of 495.42 g/mol. Its IUPAC name is 3-bromo-4-butoxy-N-[2-[(3,4-dimethylphenyl)carbamoyl]phenyl]benzamide.
| Compound Name | 3-bromo-4-butoxy-N-[2-[(3,4-dimethylphenyl)carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 4955844 |
| Molecular Formula | C26H27BrN2O3 |
| Molecular Weight | 495.42 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | 3-bromo-4-butoxy-N-[2-[(3,4-dimethylphenyl)carbamoyl]phenyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2ccccc2C(=O)Nc2ccc(C)c(C)c2)cc1Br |
| InChI | InChI=1S/C26H27BrN2O3/c1-4-5-14-32-24-13-11-19(16-22(24)27)25(30)29-23-9-7-6-8-21(23)26(31)28-20-12-10-17(2)18(3)15-20/h6-13,15-16H,4-5,14H2,1-3H3,(H,28,31)(H,29,30) |
| InChIKey | YUQHDEGVNZZBLQ-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.42 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|