C19H20IN3O3S — CID 17086926
N-[[2-(3-hydroxypropylcarbamoyl)phenyl]carbamothioyl]-3-iodo-4-methylbenzamide (PubChem CID 17086926) has the molecular formula C19H20IN3O3S and a molecular weight of 497.36 g/mol. Its IUPAC name is N-[[2-(3-hydroxypropylcarbamoyl)phenyl]carbamothioyl]-3-iodo-4-methylbenzamide.
| Compound Name | N-[[2-(3-hydroxypropylcarbamoyl)phenyl]carbamothioyl]-3-iodo-4-methylbenzamide |
|---|---|
| PubChem CID | 17086926 |
| Molecular Formula | C19H20IN3O3S |
| Molecular Weight | 497.36 g/mol |
| Exact Mass | 497.03 |
| IUPAC Name | N-[[2-(3-hydroxypropylcarbamoyl)phenyl]carbamothioyl]-3-iodo-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC(=S)Nc2ccccc2C(=O)NCCCO)cc1I |
| InChI | InChI=1S/C19H20IN3O3S/c1-12-7-8-13(11-15(12)20)17(25)23-19(27)22-16-6-3-2-5-14(16)18(26)21-9-4-10-24/h2-3,5-8,11,24H,4,9-10H2,1H3,(H,21,26)(H2,22,23,25,27) |
| InChIKey | WLVFIEHLAOPORW-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|