C25H25N3O2S — CID 17149440
N-butyl-2-[(4-phenylbenzoyl)carbamothioylamino]benzamide (PubChem CID 17149440) has the molecular formula C25H25N3O2S and a molecular weight of 431.56 g/mol. Its IUPAC name is N-butyl-2-[(4-phenylbenzoyl)carbamothioylamino]benzamide.
| Compound Name | N-butyl-2-[(4-phenylbenzoyl)carbamothioylamino]benzamide |
|---|---|
| PubChem CID | 17149440 |
| Molecular Formula | C25H25N3O2S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | N-butyl-2-[(4-phenylbenzoyl)carbamothioylamino]benzamide |
| SMILES | CCCCNC(=O)c1ccccc1NC(=S)NC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H25N3O2S/c1-2-3-17-26-24(30)21-11-7-8-12-22(21)27-25(31)28-23(29)20-15-13-19(14-16-20)18-9-5-4-6-10-18/h4-16H,2-3,17H2,1H3,(H,26,30)(H2,27,28,29,31) |
| InChIKey | SOKGCSMZHHNQAG-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|