C23H21N3O2S — CID 4949530
N-ethyl-2-[(4-phenylbenzoyl)carbamothioylamino]benzamide (PubChem CID 4949530) has the molecular formula C23H21N3O2S and a molecular weight of 403.51 g/mol. Its IUPAC name is N-ethyl-2-[(4-phenylbenzoyl)carbamothioylamino]benzamide.
| Compound Name | N-ethyl-2-[(4-phenylbenzoyl)carbamothioylamino]benzamide |
|---|---|
| PubChem CID | 4949530 |
| Molecular Formula | C23H21N3O2S |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | N-ethyl-2-[(4-phenylbenzoyl)carbamothioylamino]benzamide |
| SMILES | CCNC(=O)c1ccccc1NC(=S)NC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H21N3O2S/c1-2-24-22(28)19-10-6-7-11-20(19)25-23(29)26-21(27)18-14-12-17(13-15-18)16-8-4-3-5-9-16/h3-15H,2H2,1H3,(H,24,28)(H2,25,26,27,29) |
| InChIKey | BISCPOXHIWSXHX-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|