C21H16N2O3S — CID 4505501
2-[(4-phenylbenzoyl)carbamothioylamino]benzoic acid (PubChem CID 4505501) has the molecular formula C21H16N2O3S and a molecular weight of 376.44 g/mol. Its IUPAC name is 2-[(4-phenylbenzoyl)carbamothioylamino]benzoic acid.
| Compound Name | 2-[(4-phenylbenzoyl)carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 4505501 |
| Molecular Formula | C21H16N2O3S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 2-[(4-phenylbenzoyl)carbamothioylamino]benzoic acid |
| SMILES | O=C(NC(=S)Nc1ccccc1C(=O)O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H16N2O3S/c24-19(16-12-10-15(11-13-16)14-6-2-1-3-7-14)23-21(27)22-18-9-5-4-8-17(18)20(25)26/h1-13H,(H,25,26)(H2,22,23,24,27) |
| InChIKey | JJLRBENPAWMXKP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|