C15H11N3O5S — CID 4507533
2-[(4-nitrobenzoyl)carbamothioylamino]benzoic acid (PubChem CID 4507533) has the molecular formula C15H11N3O5S and a molecular weight of 345.34 g/mol. Its IUPAC name is 2-[(4-nitrobenzoyl)carbamothioylamino]benzoic acid.
| Compound Name | 2-[(4-nitrobenzoyl)carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 4507533 |
| Molecular Formula | C15H11N3O5S |
| Molecular Weight | 345.34 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 2-[(4-nitrobenzoyl)carbamothioylamino]benzoic acid |
| SMILES | O=C(NC(=S)Nc1ccccc1C(=O)O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H11N3O5S/c19-13(9-5-7-10(8-6-9)18(22)23)17-15(24)16-12-4-2-1-3-11(12)14(20)21/h1-8H,(H,20,21)(H2,16,17,19,24) |
| InChIKey | XSNGOJRLIFMUAS-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 121.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|