C22H24N4O4S — CID 4939105
N-cyclohexyl-N-methyl-2-[(4-nitrobenzoyl)carbamothioylamino]benzamide (PubChem CID 4939105) has the molecular formula C22H24N4O4S and a molecular weight of 440.53 g/mol. Its IUPAC name is N-cyclohexyl-N-methyl-2-[(4-nitrobenzoyl)carbamothioylamino]benzamide.
| Compound Name | N-cyclohexyl-N-methyl-2-[(4-nitrobenzoyl)carbamothioylamino]benzamide |
|---|---|
| PubChem CID | 4939105 |
| Molecular Formula | C22H24N4O4S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | N-cyclohexyl-N-methyl-2-[(4-nitrobenzoyl)carbamothioylamino]benzamide |
| SMILES | CN(C(=O)c1ccccc1NC(=S)NC(=O)c1ccc([N+](=O)[O-])cc1)C1CCCCC1 |
| InChI | InChI=1S/C22H24N4O4S/c1-25(16-7-3-2-4-8-16)21(28)18-9-5-6-10-19(18)23-22(31)24-20(27)15-11-13-17(14-12-15)26(29)30/h5-6,9-14,16H,2-4,7-8H2,1H3,(H2,23,24,27,31) |
| InChIKey | FGKZSNBSCOHDQY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|