C15H21N4O3S+ — CID 2438865
N-[methyl-(1-methylpiperidin-1-ium-4-yl)carbamothioyl]-4-nitrobenzamide (PubChem CID 2438865) has the molecular formula C15H21N4O3S+ and a molecular weight of 337.43 g/mol. Its IUPAC name is N-[methyl-(1-methylpiperidin-1-ium-4-yl)carbamothioyl]-4-nitrobenzamide.
| Compound Name | N-[methyl-(1-methylpiperidin-1-ium-4-yl)carbamothioyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 2438865 |
| Molecular Formula | C15H21N4O3S+ |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | N-[methyl-(1-methylpiperidin-1-ium-4-yl)carbamothioyl]-4-nitrobenzamide |
| SMILES | CN(C(=S)NC(=O)c1ccc([N+](=O)[O-])cc1)C1CC[NH+](C)CC1 |
| InChI | InChI=1S/C15H20N4O3S/c1-17-9-7-12(8-10-17)18(2)15(23)16-14(20)11-3-5-13(6-4-11)19(21)22/h3-6,12H,7-10H2,1-2H3,(H,16,20,23)/p+1 |
| InChIKey | OVBPJSONTCDBRI-UHFFFAOYSA-O |
| XLogP | 0.22 |
| TPSA | 79.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|