C15H21BrN3OS+ — CID 3381998
4-bromo-N-[methyl-(1-methylpiperidin-1-ium-4-yl)carbamothioyl]benzamide (PubChem CID 3381998) has the molecular formula C15H21BrN3OS+ and a molecular weight of 371.32 g/mol. Its IUPAC name is 4-bromo-N-[methyl-(1-methylpiperidin-1-ium-4-yl)carbamothioyl]benzamide.
| Compound Name | 4-bromo-N-[methyl-(1-methylpiperidin-1-ium-4-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3381998 |
| Molecular Formula | C15H21BrN3OS+ |
| Molecular Weight | 371.32 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | 4-bromo-N-[methyl-(1-methylpiperidin-1-ium-4-yl)carbamothioyl]benzamide |
| SMILES | CN(C(=S)NC(=O)c1ccc(Br)cc1)C1CC[NH+](C)CC1 |
| InChI | InChI=1S/C15H20BrN3OS/c1-18-9-7-13(8-10-18)19(2)15(21)17-14(20)11-3-5-12(16)6-4-11/h3-6,13H,7-10H2,1-2H3,(H,17,20,21)/p+1 |
| InChIKey | WURNYCGXLYPJMH-UHFFFAOYSA-O |
| XLogP | 1.07 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.32 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|