C23H27BrN2O2S — CID 17073042
3-bromo-N-[cyclohexyl(methyl)carbamothioyl]-4-(2-phenylethoxy)benzamide (PubChem CID 17073042) has the molecular formula C23H27BrN2O2S and a molecular weight of 475.45 g/mol. Its IUPAC name is 3-bromo-N-[cyclohexyl(methyl)carbamothioyl]-4-(2-phenylethoxy)benzamide.
| Compound Name | 3-bromo-N-[cyclohexyl(methyl)carbamothioyl]-4-(2-phenylethoxy)benzamide |
|---|---|
| PubChem CID | 17073042 |
| Molecular Formula | C23H27BrN2O2S |
| Molecular Weight | 475.45 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | 3-bromo-N-[cyclohexyl(methyl)carbamothioyl]-4-(2-phenylethoxy)benzamide |
| SMILES | CN(C(=S)NC(=O)c1ccc(OCCc2ccccc2)c(Br)c1)C1CCCCC1 |
| InChI | InChI=1S/C23H27BrN2O2S/c1-26(19-10-6-3-7-11-19)23(29)25-22(27)18-12-13-21(20(24)16-18)28-15-14-17-8-4-2-5-9-17/h2,4-5,8-9,12-13,16,19H,3,6-7,10-11,14-15H2,1H3,(H,25,27,29) |
| InChIKey | DAMQAQCCTKAVBL-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.45 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|