C22H26BrN3O4S — CID 54789741
N-[(3-amino-3-oxopropyl)-(2-phenylethyl)carbamothioyl]-3-bromo-4-(2-methoxyethoxy)benzamide (PubChem CID 54789741) has the molecular formula C22H26BrN3O4S and a molecular weight of 508.44 g/mol. Its IUPAC name is N-[(3-amino-3-oxopropyl)-(2-phenylethyl)carbamothioyl]-3-bromo-4-(2-methoxyethoxy)benzamide.
| Compound Name | N-[(3-amino-3-oxopropyl)-(2-phenylethyl)carbamothioyl]-3-bromo-4-(2-methoxyethoxy)benzamide |
|---|---|
| PubChem CID | 54789741 |
| Molecular Formula | C22H26BrN3O4S |
| Molecular Weight | 508.44 g/mol |
| Exact Mass | 507.08 |
| IUPAC Name | N-[(3-amino-3-oxopropyl)-(2-phenylethyl)carbamothioyl]-3-bromo-4-(2-methoxyethoxy)benzamide |
| SMILES | COCCOc1ccc(C(=O)NC(=S)N(CCC(N)=O)CCc2ccccc2)cc1Br |
| InChI | InChI=1S/C22H26BrN3O4S/c1-29-13-14-30-19-8-7-17(15-18(19)23)21(28)25-22(31)26(12-10-20(24)27)11-9-16-5-3-2-4-6-16/h2-8,15H,9-14H2,1H3,(H2,24,27)(H,25,28,31) |
| InChIKey | JSTFIWLLQMKZHR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|