C17H21BrN2O3S — CID 17356936
N-[bis(prop-2-enyl)carbamothioyl]-3-bromo-4-(2-methoxyethoxy)benzamide (PubChem CID 17356936) has the molecular formula C17H21BrN2O3S and a molecular weight of 413.34 g/mol. Its IUPAC name is N-[bis(prop-2-enyl)carbamothioyl]-3-bromo-4-(2-methoxyethoxy)benzamide.
| Compound Name | N-[bis(prop-2-enyl)carbamothioyl]-3-bromo-4-(2-methoxyethoxy)benzamide |
|---|---|
| PubChem CID | 17356936 |
| Molecular Formula | C17H21BrN2O3S |
| Molecular Weight | 413.34 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | N-[bis(prop-2-enyl)carbamothioyl]-3-bromo-4-(2-methoxyethoxy)benzamide |
| SMILES | C=CCN(CC=C)C(=S)NC(=O)c1ccc(OCCOC)c(Br)c1 |
| InChI | InChI=1S/C17H21BrN2O3S/c1-4-8-20(9-5-2)17(24)19-16(21)13-6-7-15(14(18)12-13)23-11-10-22-3/h4-7,12H,1-2,8-11H2,3H3,(H,19,21,24) |
| InChIKey | SSKIGEXOXYIOQL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.34 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|