C22H25BrN2O5S — CID 17356384
N-[4-[bis(prop-2-enyl)sulfamoyl]phenyl]-3-bromo-4-(2-methoxyethoxy)benzamide (PubChem CID 17356384) has the molecular formula C22H25BrN2O5S and a molecular weight of 509.42 g/mol. Its IUPAC name is N-[4-[bis(prop-2-enyl)sulfamoyl]phenyl]-3-bromo-4-(2-methoxyethoxy)benzamide.
| Compound Name | N-[4-[bis(prop-2-enyl)sulfamoyl]phenyl]-3-bromo-4-(2-methoxyethoxy)benzamide |
|---|---|
| PubChem CID | 17356384 |
| Molecular Formula | C22H25BrN2O5S |
| Molecular Weight | 509.42 g/mol |
| Exact Mass | 508.07 |
| IUPAC Name | N-[4-[bis(prop-2-enyl)sulfamoyl]phenyl]-3-bromo-4-(2-methoxyethoxy)benzamide |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1ccc(NC(=O)c2ccc(OCCOC)c(Br)c2)cc1 |
| InChI | InChI=1S/C22H25BrN2O5S/c1-4-12-25(13-5-2)31(27,28)19-9-7-18(8-10-19)24-22(26)17-6-11-21(20(23)16-17)30-15-14-29-3/h4-11,16H,1-2,12-15H2,3H3,(H,24,26) |
| InChIKey | JQIRXXWLGMQAAU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|