C33H32Br2N2O6 — CID 17357137
3-bromo-N-[4-[[4-[[3-bromo-4-(2-methoxyethoxy)benzoyl]amino]phenyl]methyl]phenyl]-4-(2-methoxyethoxy)benzamide (PubChem CID 17357137) has the molecular formula C33H32Br2N2O6 and a molecular weight of 712.43 g/mol. Its IUPAC name is 3-bromo-N-[4-[[4-[[3-bromo-4-(2-methoxyethoxy)benzoyl]amino]phenyl]methyl]phenyl]-4-(2-methoxyethoxy)benzamide.
| Compound Name | 3-bromo-N-[4-[[4-[[3-bromo-4-(2-methoxyethoxy)benzoyl]amino]phenyl]methyl]phenyl]-4-(2-methoxyethoxy)benzamide |
|---|---|
| PubChem CID | 17357137 |
| Molecular Formula | C33H32Br2N2O6 |
| Molecular Weight | 712.43 g/mol |
| Exact Mass | 710.06 |
| IUPAC Name | 3-bromo-N-[4-[[4-[[3-bromo-4-(2-methoxyethoxy)benzoyl]amino]phenyl]methyl]phenyl]-4-(2-methoxyethoxy)benzamide |
| SMILES | COCCOc1ccc(C(=O)Nc2ccc(Cc3ccc(NC(=O)c4ccc(OCCOC)c(Br)c4)cc3)cc2)cc1Br |
| InChI | InChI=1S/C33H32Br2N2O6/c1-40-15-17-42-30-13-7-24(20-28(30)34)32(38)36-26-9-3-22(4-10-26)19-23-5-11-27(12-6-23)37-33(39)25-8-14-31(29(35)21-25)43-18-16-41-2/h3-14,20-21H,15-19H2,1-2H3,(H,36,38)(H,37,39) |
| InChIKey | KKWVOJVWUDDIFY-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.43 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|