C28H30BrN3O5 — CID 17356679
N-[4-[[[3-bromo-4-(2-methoxyethoxy)benzoyl]amino]carbamoyl]phenyl]-4-tert-butylbenzamide (PubChem CID 17356679) has the molecular formula C28H30BrN3O5 and a molecular weight of 568.47 g/mol. Its IUPAC name is N-[4-[[[3-bromo-4-(2-methoxyethoxy)benzoyl]amino]carbamoyl]phenyl]-4-tert-butylbenzamide.
| Compound Name | N-[4-[[[3-bromo-4-(2-methoxyethoxy)benzoyl]amino]carbamoyl]phenyl]-4-tert-butylbenzamide |
|---|---|
| PubChem CID | 17356679 |
| Molecular Formula | C28H30BrN3O5 |
| Molecular Weight | 568.47 g/mol |
| Exact Mass | 567.14 |
| IUPAC Name | N-[4-[[[3-bromo-4-(2-methoxyethoxy)benzoyl]amino]carbamoyl]phenyl]-4-tert-butylbenzamide |
| SMILES | COCCOc1ccc(C(=O)NNC(=O)c2ccc(NC(=O)c3ccc(C(C)(C)C)cc3)cc2)cc1Br |
| InChI | InChI=1S/C28H30BrN3O5/c1-28(2,3)21-10-5-18(6-11-21)25(33)30-22-12-7-19(8-13-22)26(34)31-32-27(35)20-9-14-24(23(29)17-20)37-16-15-36-4/h5-14,17H,15-16H2,1-4H3,(H,30,33)(H,31,34)(H,32,35) |
| InChIKey | JRXRVRVYLIINQI-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.47 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|