C24H28BrN3O5 — CID 17356671
N-[4-[[[3-bromo-4-(2-methoxyethoxy)benzoyl]amino]carbamoyl]phenyl]cyclohexanecarboxamide (PubChem CID 17356671) has the molecular formula C24H28BrN3O5 and a molecular weight of 518.41 g/mol. Its IUPAC name is N-[4-[[[3-bromo-4-(2-methoxyethoxy)benzoyl]amino]carbamoyl]phenyl]cyclohexanecarboxamide.
| Compound Name | N-[4-[[[3-bromo-4-(2-methoxyethoxy)benzoyl]amino]carbamoyl]phenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 17356671 |
| Molecular Formula | C24H28BrN3O5 |
| Molecular Weight | 518.41 g/mol |
| Exact Mass | 517.12 |
| IUPAC Name | N-[4-[[[3-bromo-4-(2-methoxyethoxy)benzoyl]amino]carbamoyl]phenyl]cyclohexanecarboxamide |
| SMILES | COCCOc1ccc(C(=O)NNC(=O)c2ccc(NC(=O)C3CCCCC3)cc2)cc1Br |
| InChI | InChI=1S/C24H28BrN3O5/c1-32-13-14-33-21-12-9-18(15-20(21)25)24(31)28-27-23(30)17-7-10-19(11-8-17)26-22(29)16-5-3-2-4-6-16/h7-12,15-16H,2-6,13-14H2,1H3,(H,26,29)(H,27,30)(H,28,31) |
| InChIKey | JTEVHWPZSCKQCY-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|