C26H32BrN3O4 — CID 17350317
N-[4-[[[2-(2-bromo-4-tert-butylphenoxy)acetyl]amino]carbamoyl]phenyl]cyclohexanecarboxamide (PubChem CID 17350317) has the molecular formula C26H32BrN3O4 and a molecular weight of 530.46 g/mol. Its IUPAC name is N-[4-[[[2-(2-bromo-4-tert-butylphenoxy)acetyl]amino]carbamoyl]phenyl]cyclohexanecarboxamide.
| Compound Name | N-[4-[[[2-(2-bromo-4-tert-butylphenoxy)acetyl]amino]carbamoyl]phenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 17350317 |
| Molecular Formula | C26H32BrN3O4 |
| Molecular Weight | 530.46 g/mol |
| Exact Mass | 529.16 |
| IUPAC Name | N-[4-[[[2-(2-bromo-4-tert-butylphenoxy)acetyl]amino]carbamoyl]phenyl]cyclohexanecarboxamide |
| SMILES | CC(C)(C)c1ccc(OCC(=O)NNC(=O)c2ccc(NC(=O)C3CCCCC3)cc2)c(Br)c1 |
| InChI | InChI=1S/C26H32BrN3O4/c1-26(2,3)19-11-14-22(21(27)15-19)34-16-23(31)29-30-25(33)18-9-12-20(13-10-18)28-24(32)17-7-5-4-6-8-17/h9-15,17H,4-8,16H2,1-3H3,(H,28,32)(H,29,31)(H,30,33) |
| InChIKey | QRXUUCFQZIMIJI-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.46 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|