C24H27BrN4O4S — CID 4504416
N-[4-[[[2-(2-bromo-4-methylphenoxy)acetyl]carbamothioylamino]carbamoyl]phenyl]cyclohexanecarboxamide (PubChem CID 4504416) has the molecular formula C24H27BrN4O4S and a molecular weight of 547.48 g/mol. Its IUPAC name is N-[4-[[[2-(2-bromo-4-methylphenoxy)acetyl]carbamothioylamino]carbamoyl]phenyl]cyclohexanecarboxamide.
| Compound Name | N-[4-[[[2-(2-bromo-4-methylphenoxy)acetyl]carbamothioylamino]carbamoyl]phenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 4504416 |
| Molecular Formula | C24H27BrN4O4S |
| Molecular Weight | 547.48 g/mol |
| Exact Mass | 546.09 |
| IUPAC Name | N-[4-[[[2-(2-bromo-4-methylphenoxy)acetyl]carbamothioylamino]carbamoyl]phenyl]cyclohexanecarboxamide |
| SMILES | Cc1ccc(OCC(=O)NC(=S)NNC(=O)c2ccc(NC(=O)C3CCCCC3)cc2)c(Br)c1 |
| InChI | InChI=1S/C24H27BrN4O4S/c1-15-7-12-20(19(25)13-15)33-14-21(30)27-24(34)29-28-23(32)17-8-10-18(11-9-17)26-22(31)16-5-3-2-4-6-16/h7-13,16H,2-6,14H2,1H3,(H,26,31)(H,28,32)(H2,27,29,30,34) |
| InChIKey | YAMISOSVIYMYDH-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.48 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|