C23H25BrN4O4S — CID 4956224
3-bromo-4-butoxy-N-[[[4-(cyclopropanecarbonylamino)benzoyl]amino]carbamothioyl]benzamide (PubChem CID 4956224) has the molecular formula C23H25BrN4O4S and a molecular weight of 533.45 g/mol. Its IUPAC name is 3-bromo-4-butoxy-N-[[[4-(cyclopropanecarbonylamino)benzoyl]amino]carbamothioyl]benzamide.
| Compound Name | 3-bromo-4-butoxy-N-[[[4-(cyclopropanecarbonylamino)benzoyl]amino]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4956224 |
| Molecular Formula | C23H25BrN4O4S |
| Molecular Weight | 533.45 g/mol |
| Exact Mass | 532.08 |
| IUPAC Name | 3-bromo-4-butoxy-N-[[[4-(cyclopropanecarbonylamino)benzoyl]amino]carbamothioyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)NC(=S)NNC(=O)c2ccc(NC(=O)C3CC3)cc2)cc1Br |
| InChI | InChI=1S/C23H25BrN4O4S/c1-2-3-12-32-19-11-8-16(13-18(19)24)21(30)26-23(33)28-27-22(31)15-6-9-17(10-7-15)25-20(29)14-4-5-14/h6-11,13-14H,2-5,12H2,1H3,(H,25,29)(H,27,31)(H2,26,28,30,33) |
| InChIKey | JMKPTEMLYLOOJN-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|