C30H31BrN4O4S — CID 17073185
3-bromo-N-[[[4-(cyclohexanecarbonylamino)benzoyl]amino]carbamothioyl]-4-(2-phenylethoxy)benzamide (PubChem CID 17073185) has the molecular formula C30H31BrN4O4S and a molecular weight of 623.57 g/mol. Its IUPAC name is 3-bromo-N-[[[4-(cyclohexanecarbonylamino)benzoyl]amino]carbamothioyl]-4-(2-phenylethoxy)benzamide.
| Compound Name | 3-bromo-N-[[[4-(cyclohexanecarbonylamino)benzoyl]amino]carbamothioyl]-4-(2-phenylethoxy)benzamide |
|---|---|
| PubChem CID | 17073185 |
| Molecular Formula | C30H31BrN4O4S |
| Molecular Weight | 623.57 g/mol |
| Exact Mass | 622.12 |
| IUPAC Name | 3-bromo-N-[[[4-(cyclohexanecarbonylamino)benzoyl]amino]carbamothioyl]-4-(2-phenylethoxy)benzamide |
| SMILES | O=C(NNC(=S)NC(=O)c1ccc(OCCc2ccccc2)c(Br)c1)c1ccc(NC(=O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C30H31BrN4O4S/c31-25-19-23(13-16-26(25)39-18-17-20-7-3-1-4-8-20)28(37)33-30(40)35-34-29(38)22-11-14-24(15-12-22)32-27(36)21-9-5-2-6-10-21/h1,3-4,7-8,11-16,19,21H,2,5-6,9-10,17-18H2,(H,32,36)(H,34,38)(H2,33,35,37,40) |
| InChIKey | RBLXBLHXXACIGM-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.57 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|