C24H23BrN2O4S — CID 54781616
3-bromo-N-[(3,4-dimethoxyphenyl)carbamothioyl]-4-(2-phenylethoxy)benzamide (PubChem CID 54781616) has the molecular formula C24H23BrN2O4S and a molecular weight of 515.43 g/mol. Its IUPAC name is 3-bromo-N-[(3,4-dimethoxyphenyl)carbamothioyl]-4-(2-phenylethoxy)benzamide.
| Compound Name | 3-bromo-N-[(3,4-dimethoxyphenyl)carbamothioyl]-4-(2-phenylethoxy)benzamide |
|---|---|
| PubChem CID | 54781616 |
| Molecular Formula | C24H23BrN2O4S |
| Molecular Weight | 515.43 g/mol |
| Exact Mass | 514.06 |
| IUPAC Name | 3-bromo-N-[(3,4-dimethoxyphenyl)carbamothioyl]-4-(2-phenylethoxy)benzamide |
| SMILES | COc1ccc(NC(=S)NC(=O)c2ccc(OCCc3ccccc3)c(Br)c2)cc1OC |
| InChI | InChI=1S/C24H23BrN2O4S/c1-29-21-11-9-18(15-22(21)30-2)26-24(32)27-23(28)17-8-10-20(19(25)14-17)31-13-12-16-6-4-3-5-7-16/h3-11,14-15H,12-13H2,1-2H3,(H2,26,27,28,32) |
| InChIKey | FWNXXRHUNYWFST-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.43 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|