C31H28BrN3O3S — CID 17229967
3-bromo-N-[[4-[ethyl(phenyl)carbamoyl]phenyl]carbamothioyl]-4-(2-phenylethoxy)benzamide (PubChem CID 17229967) has the molecular formula C31H28BrN3O3S and a molecular weight of 602.55 g/mol. Its IUPAC name is 3-bromo-N-[[4-[ethyl(phenyl)carbamoyl]phenyl]carbamothioyl]-4-(2-phenylethoxy)benzamide.
| Compound Name | 3-bromo-N-[[4-[ethyl(phenyl)carbamoyl]phenyl]carbamothioyl]-4-(2-phenylethoxy)benzamide |
|---|---|
| PubChem CID | 17229967 |
| Molecular Formula | C31H28BrN3O3S |
| Molecular Weight | 602.55 g/mol |
| Exact Mass | 601.10 |
| IUPAC Name | 3-bromo-N-[[4-[ethyl(phenyl)carbamoyl]phenyl]carbamothioyl]-4-(2-phenylethoxy)benzamide |
| SMILES | CCN(C(=O)c1ccc(NC(=S)NC(=O)c2ccc(OCCc3ccccc3)c(Br)c2)cc1)c1ccccc1 |
| InChI | InChI=1S/C31H28BrN3O3S/c1-2-35(26-11-7-4-8-12-26)30(37)23-13-16-25(17-14-23)33-31(39)34-29(36)24-15-18-28(27(32)21-24)38-20-19-22-9-5-3-6-10-22/h3-18,21H,2,19-20H2,1H3,(H2,33,34,36,39) |
| InChIKey | IWAKUIKUZZBCTB-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.55 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|