C29H32BrN3O3S — CID 17186866
3-bromo-N-[[2-[ethyl(phenyl)carbamoyl]phenyl]carbamothioyl]-4-hexoxybenzamide (PubChem CID 17186866) has the molecular formula C29H32BrN3O3S and a molecular weight of 582.56 g/mol. Its IUPAC name is 3-bromo-N-[[2-[ethyl(phenyl)carbamoyl]phenyl]carbamothioyl]-4-hexoxybenzamide.
| Compound Name | 3-bromo-N-[[2-[ethyl(phenyl)carbamoyl]phenyl]carbamothioyl]-4-hexoxybenzamide |
|---|---|
| PubChem CID | 17186866 |
| Molecular Formula | C29H32BrN3O3S |
| Molecular Weight | 582.56 g/mol |
| Exact Mass | 581.13 |
| IUPAC Name | 3-bromo-N-[[2-[ethyl(phenyl)carbamoyl]phenyl]carbamothioyl]-4-hexoxybenzamide |
| SMILES | CCCCCCOc1ccc(C(=O)NC(=S)Nc2ccccc2C(=O)N(CC)c2ccccc2)cc1Br |
| InChI | InChI=1S/C29H32BrN3O3S/c1-3-5-6-12-19-36-26-18-17-21(20-24(26)30)27(34)32-29(37)31-25-16-11-10-15-23(25)28(35)33(4-2)22-13-8-7-9-14-22/h7-11,13-18,20H,3-6,12,19H2,1-2H3,(H2,31,32,34,37) |
| InChIKey | NFAGELUQORFDCX-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.56 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|