C24H22IN3O2S — CID 17229895
N-[[4-[ethyl(phenyl)carbamoyl]phenyl]carbamothioyl]-3-iodo-4-methylbenzamide (PubChem CID 17229895) has the molecular formula C24H22IN3O2S and a molecular weight of 543.43 g/mol. Its IUPAC name is N-[[4-[ethyl(phenyl)carbamoyl]phenyl]carbamothioyl]-3-iodo-4-methylbenzamide.
| Compound Name | N-[[4-[ethyl(phenyl)carbamoyl]phenyl]carbamothioyl]-3-iodo-4-methylbenzamide |
|---|---|
| PubChem CID | 17229895 |
| Molecular Formula | C24H22IN3O2S |
| Molecular Weight | 543.43 g/mol |
| Exact Mass | 543.05 |
| IUPAC Name | N-[[4-[ethyl(phenyl)carbamoyl]phenyl]carbamothioyl]-3-iodo-4-methylbenzamide |
| SMILES | CCN(C(=O)c1ccc(NC(=S)NC(=O)c2ccc(C)c(I)c2)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H22IN3O2S/c1-3-28(20-7-5-4-6-8-20)23(30)17-11-13-19(14-12-17)26-24(31)27-22(29)18-10-9-16(2)21(25)15-18/h4-15H,3H2,1-2H3,(H2,26,27,29,31) |
| InChIKey | GZIBFHHQRDMBHX-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.43 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|