C17H16IN3O2S — CID 28642902
3-iodo-4-methyl-N-[[4-(methylcarbamoyl)phenyl]carbamothioyl]benzamide (PubChem CID 28642902) has the molecular formula C17H16IN3O2S and a molecular weight of 453.31 g/mol. Its IUPAC name is 3-iodo-4-methyl-N-[[4-(methylcarbamoyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 3-iodo-4-methyl-N-[[4-(methylcarbamoyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 28642902 |
| Molecular Formula | C17H16IN3O2S |
| Molecular Weight | 453.31 g/mol |
| Exact Mass | 453.00 |
| IUPAC Name | 3-iodo-4-methyl-N-[[4-(methylcarbamoyl)phenyl]carbamothioyl]benzamide |
| SMILES | CNC(=O)c1ccc(NC(=S)NC(=O)c2ccc(C)c(I)c2)cc1 |
| InChI | InChI=1S/C17H16IN3O2S/c1-10-3-4-12(9-14(10)18)16(23)21-17(24)20-13-7-5-11(6-8-13)15(22)19-2/h3-9H,1-2H3,(H,19,22)(H2,20,21,23,24) |
| InChIKey | CTWWQCPWYWCRAB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|