C16H15IN2O2S — CID 5121233
N-[(2-hydroxy-5-methylphenyl)carbamothioyl]-3-iodo-4-methylbenzamide (PubChem CID 5121233) has the molecular formula C16H15IN2O2S and a molecular weight of 426.28 g/mol. Its IUPAC name is N-[(2-hydroxy-5-methylphenyl)carbamothioyl]-3-iodo-4-methylbenzamide.
| Compound Name | N-[(2-hydroxy-5-methylphenyl)carbamothioyl]-3-iodo-4-methylbenzamide |
|---|---|
| PubChem CID | 5121233 |
| Molecular Formula | C16H15IN2O2S |
| Molecular Weight | 426.28 g/mol |
| Exact Mass | 425.99 |
| IUPAC Name | N-[(2-hydroxy-5-methylphenyl)carbamothioyl]-3-iodo-4-methylbenzamide |
| SMILES | Cc1ccc(O)c(NC(=S)NC(=O)c2ccc(C)c(I)c2)c1 |
| InChI | InChI=1S/C16H15IN2O2S/c1-9-3-6-14(20)13(7-9)18-16(22)19-15(21)11-5-4-10(2)12(17)8-11/h3-8,20H,1-2H3,(H2,18,19,21,22) |
| InChIKey | UFUHRNCCERZDRR-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.28 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|