C18H20N2O5S — CID 5172592
N-[(2-hydroxy-5-methylphenyl)carbamothioyl]-3,4,5-trimethoxybenzamide (PubChem CID 5172592) has the molecular formula C18H20N2O5S and a molecular weight of 376.43 g/mol. Its IUPAC name is N-[(2-hydroxy-5-methylphenyl)carbamothioyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[(2-hydroxy-5-methylphenyl)carbamothioyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 5172592 |
| Molecular Formula | C18H20N2O5S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | N-[(2-hydroxy-5-methylphenyl)carbamothioyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NC(=S)Nc2cc(C)ccc2O)cc(OC)c1OC |
| InChI | InChI=1S/C18H20N2O5S/c1-10-5-6-13(21)12(7-10)19-18(26)20-17(22)11-8-14(23-2)16(25-4)15(9-11)24-3/h5-9,21H,1-4H3,(H2,19,20,22,26) |
| InChIKey | JAGGRBATHGAEBZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|