C18H17ClN2O6S — CID 28688493
4-chloro-3-[(3,4,5-trimethoxybenzoyl)carbamothioylamino]benzoic acid (PubChem CID 28688493) has the molecular formula C18H17ClN2O6S and a molecular weight of 424.86 g/mol. Its IUPAC name is 4-chloro-3-[(3,4,5-trimethoxybenzoyl)carbamothioylamino]benzoic acid.
| Compound Name | 4-chloro-3-[(3,4,5-trimethoxybenzoyl)carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 28688493 |
| Molecular Formula | C18H17ClN2O6S |
| Molecular Weight | 424.86 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | 4-chloro-3-[(3,4,5-trimethoxybenzoyl)carbamothioylamino]benzoic acid |
| SMILES | COc1cc(C(=O)NC(=S)Nc2cc(C(=O)O)ccc2Cl)cc(OC)c1OC |
| InChI | InChI=1S/C18H17ClN2O6S/c1-25-13-7-10(8-14(26-2)15(13)27-3)16(22)21-18(28)20-12-6-9(17(23)24)4-5-11(12)19/h4-8H,1-3H3,(H,23,24)(H2,20,21,22,28) |
| InChIKey | YEKNECMKWVBTHE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.86 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|