C17H14Cl2N2O5S — CID 22778973
3-[(3,5-dichloro-4-methoxybenzoyl)carbamothioylamino]-4-methoxybenzoic acid (PubChem CID 22778973) has the molecular formula C17H14Cl2N2O5S and a molecular weight of 429.28 g/mol. Its IUPAC name is 3-[(3,5-dichloro-4-methoxybenzoyl)carbamothioylamino]-4-methoxybenzoic acid.
| Compound Name | 3-[(3,5-dichloro-4-methoxybenzoyl)carbamothioylamino]-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 22778973 |
| Molecular Formula | C17H14Cl2N2O5S |
| Molecular Weight | 429.28 g/mol |
| Exact Mass | 428.00 |
| IUPAC Name | 3-[(3,5-dichloro-4-methoxybenzoyl)carbamothioylamino]-4-methoxybenzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1NC(=S)NC(=O)c1cc(Cl)c(OC)c(Cl)c1 |
| InChI | InChI=1S/C17H14Cl2N2O5S/c1-25-13-4-3-8(16(23)24)7-12(13)20-17(27)21-15(22)9-5-10(18)14(26-2)11(19)6-9/h3-7H,1-2H3,(H,23,24)(H2,20,21,22,27) |
| InChIKey | PCGJRKJXHZNCJZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.28 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|