C17H15N3O7S — CID 91673621
4-methoxy-3-[(4-methoxy-3-nitrobenzoyl)carbamothioylamino]benzoic acid (PubChem CID 91673621) has the molecular formula C17H15N3O7S and a molecular weight of 405.39 g/mol. Its IUPAC name is 4-methoxy-3-[(4-methoxy-3-nitrobenzoyl)carbamothioylamino]benzoic acid.
| Compound Name | 4-methoxy-3-[(4-methoxy-3-nitrobenzoyl)carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 91673621 |
| Molecular Formula | C17H15N3O7S |
| Molecular Weight | 405.39 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | 4-methoxy-3-[(4-methoxy-3-nitrobenzoyl)carbamothioylamino]benzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1NC(=S)NC(=O)c1ccc(OC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H15N3O7S/c1-26-13-5-4-10(16(22)23)7-11(13)18-17(28)19-15(21)9-3-6-14(27-2)12(8-9)20(24)25/h3-8H,1-2H3,(H,22,23)(H2,18,19,21,28) |
| InChIKey | ZJFJDFRJAQBKLZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 140.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|