C17H16N2O8 — CID 1260419
4,5-dimethoxy-2-[(4-methoxy-3-nitrobenzoyl)amino]benzoic acid (PubChem CID 1260419) has the molecular formula C17H16N2O8 and a molecular weight of 376.32 g/mol. Its IUPAC name is 4,5-dimethoxy-2-[(4-methoxy-3-nitrobenzoyl)amino]benzoic acid.
| Compound Name | 4,5-dimethoxy-2-[(4-methoxy-3-nitrobenzoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 1260419 |
| Molecular Formula | C17H16N2O8 |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 4,5-dimethoxy-2-[(4-methoxy-3-nitrobenzoyl)amino]benzoic acid |
| SMILES | COc1cc(NC(=O)c2ccc(OC)c([N+](=O)[O-])c2)c(C(=O)O)cc1OC |
| InChI | InChI=1S/C17H16N2O8/c1-25-13-5-4-9(6-12(13)19(23)24)16(20)18-11-8-15(27-3)14(26-2)7-10(11)17(21)22/h4-8H,1-3H3,(H,18,20)(H,21,22) |
| InChIKey | JJVJIGPFBINOHD-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 137.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|