C16H12ClN3O5S — CID 4506643
4-chloro-3-[(3-methyl-4-nitrobenzoyl)carbamothioylamino]benzoic acid (PubChem CID 4506643) has the molecular formula C16H12ClN3O5S and a molecular weight of 393.81 g/mol. Its IUPAC name is 4-chloro-3-[(3-methyl-4-nitrobenzoyl)carbamothioylamino]benzoic acid.
| Compound Name | 4-chloro-3-[(3-methyl-4-nitrobenzoyl)carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 4506643 |
| Molecular Formula | C16H12ClN3O5S |
| Molecular Weight | 393.81 g/mol |
| Exact Mass | 393.02 |
| IUPAC Name | 4-chloro-3-[(3-methyl-4-nitrobenzoyl)carbamothioylamino]benzoic acid |
| SMILES | Cc1cc(C(=O)NC(=S)Nc2cc(C(=O)O)ccc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H12ClN3O5S/c1-8-6-9(3-5-13(8)20(24)25)14(21)19-16(26)18-12-7-10(15(22)23)2-4-11(12)17/h2-7H,1H3,(H,22,23)(H2,18,19,21,26) |
| InChIKey | IUPBAPSDYGMHDN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 121.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.81 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|