C16H13ClN4O5S — CID 22775384
N-[(5-chloro-2-methyl-4-nitrophenyl)carbamothioyl]-4-methyl-3-nitrobenzamide (PubChem CID 22775384) has the molecular formula C16H13ClN4O5S and a molecular weight of 408.82 g/mol. Its IUPAC name is N-[(5-chloro-2-methyl-4-nitrophenyl)carbamothioyl]-4-methyl-3-nitrobenzamide.
| Compound Name | N-[(5-chloro-2-methyl-4-nitrophenyl)carbamothioyl]-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 22775384 |
| Molecular Formula | C16H13ClN4O5S |
| Molecular Weight | 408.82 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | N-[(5-chloro-2-methyl-4-nitrophenyl)carbamothioyl]-4-methyl-3-nitrobenzamide |
| SMILES | Cc1cc([N+](=O)[O-])c(Cl)cc1NC(=S)NC(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H13ClN4O5S/c1-8-3-4-10(6-13(8)20(23)24)15(22)19-16(27)18-12-7-11(17)14(21(25)26)5-9(12)2/h3-7H,1-2H3,(H2,18,19,22,27) |
| InChIKey | HZVOPMQRNMCNRC-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 127.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.82 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|