C17H16IN3O3S — CID 17104856
N-[(4-iodo-2,5-dimethylphenyl)carbamothioyl]-4-methyl-3-nitrobenzamide (PubChem CID 17104856) has the molecular formula C17H16IN3O3S and a molecular weight of 469.30 g/mol. Its IUPAC name is N-[(4-iodo-2,5-dimethylphenyl)carbamothioyl]-4-methyl-3-nitrobenzamide.
| Compound Name | N-[(4-iodo-2,5-dimethylphenyl)carbamothioyl]-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 17104856 |
| Molecular Formula | C17H16IN3O3S |
| Molecular Weight | 469.30 g/mol |
| Exact Mass | 469.00 |
| IUPAC Name | N-[(4-iodo-2,5-dimethylphenyl)carbamothioyl]-4-methyl-3-nitrobenzamide |
| SMILES | Cc1cc(NC(=S)NC(=O)c2ccc(C)c([N+](=O)[O-])c2)c(C)cc1I |
| InChI | InChI=1S/C17H16IN3O3S/c1-9-4-5-12(8-15(9)21(23)24)16(22)20-17(25)19-14-7-10(2)13(18)6-11(14)3/h4-8H,1-3H3,(H2,19,20,22,25) |
| InChIKey | MJOKNQJFGHBPFD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.30 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|