C16H15N3O3S — CID 2198865
4-methyl-N-[(4-methyl-3-nitrophenyl)carbamothioyl]benzamide (PubChem CID 2198865) has the molecular formula C16H15N3O3S and a molecular weight of 329.38 g/mol. Its IUPAC name is 4-methyl-N-[(4-methyl-3-nitrophenyl)carbamothioyl]benzamide.
| Compound Name | 4-methyl-N-[(4-methyl-3-nitrophenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 2198865 |
| Molecular Formula | C16H15N3O3S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 4-methyl-N-[(4-methyl-3-nitrophenyl)carbamothioyl]benzamide |
| SMILES | Cc1ccc(C(=O)NC(=S)Nc2ccc(C)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C16H15N3O3S/c1-10-3-6-12(7-4-10)15(20)18-16(23)17-13-8-5-11(2)14(9-13)19(21)22/h3-9H,1-2H3,(H2,17,18,20,23) |
| InChIKey | RKIFNZUQBIQDMU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|