C18H19N3O2S — CID 54777506
N-[(3-acetamido-4-methylphenyl)carbamothioyl]-4-methylbenzamide (PubChem CID 54777506) has the molecular formula C18H19N3O2S and a molecular weight of 341.44 g/mol. Its IUPAC name is N-[(3-acetamido-4-methylphenyl)carbamothioyl]-4-methylbenzamide.
| Compound Name | N-[(3-acetamido-4-methylphenyl)carbamothioyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 54777506 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | N-[(3-acetamido-4-methylphenyl)carbamothioyl]-4-methylbenzamide |
| SMILES | CC(=O)Nc1cc(NC(=S)NC(=O)c2ccc(C)cc2)ccc1C |
| InChI | InChI=1S/C18H19N3O2S/c1-11-4-7-14(8-5-11)17(23)21-18(24)20-15-9-6-12(2)16(10-15)19-13(3)22/h4-10H,1-3H3,(H,19,22)(H2,20,21,23,24) |
| InChIKey | FKAVCBAZVOJSLT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|