C19H20N4O2S2 — CID 1306540
4-methyl-N-[[4-(propanoylcarbamothioylamino)phenyl]carbamothioyl]benzamide (PubChem CID 1306540) has the molecular formula C19H20N4O2S2 and a molecular weight of 400.53 g/mol. Its IUPAC name is 4-methyl-N-[[4-(propanoylcarbamothioylamino)phenyl]carbamothioyl]benzamide.
| Compound Name | 4-methyl-N-[[4-(propanoylcarbamothioylamino)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 1306540 |
| Molecular Formula | C19H20N4O2S2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | 4-methyl-N-[[4-(propanoylcarbamothioylamino)phenyl]carbamothioyl]benzamide |
| SMILES | CCC(=O)NC(=S)Nc1ccc(NC(=S)NC(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C19H20N4O2S2/c1-3-16(24)22-18(26)20-14-8-10-15(11-9-14)21-19(27)23-17(25)13-6-4-12(2)5-7-13/h4-11H,3H2,1-2H3,(H2,20,22,24,26)(H2,21,23,25,27) |
| InChIKey | QNNVAGNKCAAATK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|