C19H19ClN4O2S2 — CID 4635327
2-chloro-4-methyl-N-[[4-(propanoylcarbamothioylamino)phenyl]carbamothioyl]benzamide (PubChem CID 4635327) has the molecular formula C19H19ClN4O2S2 and a molecular weight of 434.97 g/mol. Its IUPAC name is 2-chloro-4-methyl-N-[[4-(propanoylcarbamothioylamino)phenyl]carbamothioyl]benzamide.
| Compound Name | 2-chloro-4-methyl-N-[[4-(propanoylcarbamothioylamino)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4635327 |
| Molecular Formula | C19H19ClN4O2S2 |
| Molecular Weight | 434.97 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | 2-chloro-4-methyl-N-[[4-(propanoylcarbamothioylamino)phenyl]carbamothioyl]benzamide |
| SMILES | CCC(=O)NC(=S)Nc1ccc(NC(=S)NC(=O)c2ccc(C)cc2Cl)cc1 |
| InChI | InChI=1S/C19H19ClN4O2S2/c1-3-16(25)23-18(27)21-12-5-7-13(8-6-12)22-19(28)24-17(26)14-9-4-11(2)10-15(14)20/h4-10H,3H2,1-2H3,(H2,21,23,25,27)(H2,22,24,26,28) |
| InChIKey | CCBJGNQAMNIFCZ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.97 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|