C17H16ClN3O2S — CID 1227605
2-chloro-N-[[3-(propanoylamino)phenyl]carbamothioyl]benzamide (PubChem CID 1227605) has the molecular formula C17H16ClN3O2S and a molecular weight of 361.85 g/mol. Its IUPAC name is 2-chloro-N-[[3-(propanoylamino)phenyl]carbamothioyl]benzamide.
| Compound Name | 2-chloro-N-[[3-(propanoylamino)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 1227605 |
| Molecular Formula | C17H16ClN3O2S |
| Molecular Weight | 361.85 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 2-chloro-N-[[3-(propanoylamino)phenyl]carbamothioyl]benzamide |
| SMILES | CCC(=O)Nc1cccc(NC(=S)NC(=O)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C17H16ClN3O2S/c1-2-15(22)19-11-6-5-7-12(10-11)20-17(24)21-16(23)13-8-3-4-9-14(13)18/h3-10H,2H2,1H3,(H,19,22)(H2,20,21,23,24) |
| InChIKey | BTJIXTJOZVBTOL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.85 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|