C22H14ClF4N3O3S — CID 17114280
N-[[3-[(2-chlorobenzoyl)amino]phenyl]carbamothioyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide (PubChem CID 17114280) has the molecular formula C22H14ClF4N3O3S and a molecular weight of 511.88 g/mol. Its IUPAC name is N-[[3-[(2-chlorobenzoyl)amino]phenyl]carbamothioyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide.
| Compound Name | N-[[3-[(2-chlorobenzoyl)amino]phenyl]carbamothioyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide |
|---|---|
| PubChem CID | 17114280 |
| Molecular Formula | C22H14ClF4N3O3S |
| Molecular Weight | 511.88 g/mol |
| Exact Mass | 511.04 |
| IUPAC Name | N-[[3-[(2-chlorobenzoyl)amino]phenyl]carbamothioyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide |
| SMILES | COc1c(F)c(F)c(C(=O)NC(=S)Nc2cccc(NC(=O)c3ccccc3Cl)c2)c(F)c1F |
| InChI | InChI=1S/C22H14ClF4N3O3S/c1-33-19-17(26)15(24)14(16(25)18(19)27)21(32)30-22(34)29-11-6-4-5-10(9-11)28-20(31)12-7-2-3-8-13(12)23/h2-9H,1H3,(H,28,31)(H2,29,30,32,34) |
| InChIKey | PFUXUVZPIJVDTP-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.88 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|