C25H18ClN3O2S — CID 1342378
N-[[3-[(2-chlorobenzoyl)amino]phenyl]carbamothioyl]naphthalene-1-carboxamide (PubChem CID 1342378) has the molecular formula C25H18ClN3O2S and a molecular weight of 459.96 g/mol. Its IUPAC name is N-[[3-[(2-chlorobenzoyl)amino]phenyl]carbamothioyl]naphthalene-1-carboxamide.
| Compound Name | N-[[3-[(2-chlorobenzoyl)amino]phenyl]carbamothioyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 1342378 |
| Molecular Formula | C25H18ClN3O2S |
| Molecular Weight | 459.96 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | N-[[3-[(2-chlorobenzoyl)amino]phenyl]carbamothioyl]naphthalene-1-carboxamide |
| SMILES | O=C(Nc1cccc(NC(=S)NC(=O)c2cccc3ccccc23)c1)c1ccccc1Cl |
| InChI | InChI=1S/C25H18ClN3O2S/c26-22-14-4-3-12-21(22)24(31)27-17-9-6-10-18(15-17)28-25(32)29-23(30)20-13-5-8-16-7-1-2-11-19(16)20/h1-15H,(H,27,31)(H2,28,29,30,32) |
| InChIKey | QUGWWLYWYGLFDO-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.96 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|