C27H19N3O3S — CID 17109692
N-[4-(naphthalene-1-carbonylcarbamothioylamino)phenyl]-1-benzofuran-2-carboxamide (PubChem CID 17109692) has the molecular formula C27H19N3O3S and a molecular weight of 465.53 g/mol. Its IUPAC name is N-[4-(naphthalene-1-carbonylcarbamothioylamino)phenyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[4-(naphthalene-1-carbonylcarbamothioylamino)phenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 17109692 |
| Molecular Formula | C27H19N3O3S |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | N-[4-(naphthalene-1-carbonylcarbamothioylamino)phenyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(Nc1ccc(NC(=S)NC(=O)c2cccc3ccccc23)cc1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C27H19N3O3S/c31-25(22-10-5-8-17-6-1-3-9-21(17)22)30-27(34)29-20-14-12-19(13-15-20)28-26(32)24-16-18-7-2-4-11-23(18)33-24/h1-16H,(H,28,32)(H2,29,30,31,34) |
| InChIKey | KQHPIASOIODYRM-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|