C24H18N4O5S — CID 17115643
N-[4-[(2-methyl-3-nitrobenzoyl)carbamothioylamino]phenyl]-1-benzofuran-2-carboxamide (PubChem CID 17115643) has the molecular formula C24H18N4O5S and a molecular weight of 474.50 g/mol. Its IUPAC name is N-[4-[(2-methyl-3-nitrobenzoyl)carbamothioylamino]phenyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[4-[(2-methyl-3-nitrobenzoyl)carbamothioylamino]phenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 17115643 |
| Molecular Formula | C24H18N4O5S |
| Molecular Weight | 474.50 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | N-[4-[(2-methyl-3-nitrobenzoyl)carbamothioylamino]phenyl]-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)NC(=S)Nc2ccc(NC(=O)c3cc4ccccc4o3)cc2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H18N4O5S/c1-14-18(6-4-7-19(14)28(31)32)22(29)27-24(34)26-17-11-9-16(10-12-17)25-23(30)21-13-15-5-2-3-8-20(15)33-21/h2-13H,1H3,(H,25,30)(H2,26,27,29,34) |
| InChIKey | IPBDFYWXLUMXJA-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 126.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.50 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|