C25H20BrN3O4S — CID 17317180
N-[4-[(5-bromo-2-methoxy-3-methylbenzoyl)carbamothioylamino]phenyl]-1-benzofuran-2-carboxamide (PubChem CID 17317180) has the molecular formula C25H20BrN3O4S and a molecular weight of 538.42 g/mol. Its IUPAC name is N-[4-[(5-bromo-2-methoxy-3-methylbenzoyl)carbamothioylamino]phenyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[4-[(5-bromo-2-methoxy-3-methylbenzoyl)carbamothioylamino]phenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 17317180 |
| Molecular Formula | C25H20BrN3O4S |
| Molecular Weight | 538.42 g/mol |
| Exact Mass | 537.04 |
| IUPAC Name | N-[4-[(5-bromo-2-methoxy-3-methylbenzoyl)carbamothioylamino]phenyl]-1-benzofuran-2-carboxamide |
| SMILES | COc1c(C)cc(Br)cc1C(=O)NC(=S)Nc1ccc(NC(=O)c2cc3ccccc3o2)cc1 |
| InChI | InChI=1S/C25H20BrN3O4S/c1-14-11-16(26)13-19(22(14)32-2)23(30)29-25(34)28-18-9-7-17(8-10-18)27-24(31)21-12-15-5-3-4-6-20(15)33-21/h3-13H,1-2H3,(H,27,31)(H2,28,29,30,34) |
| InChIKey | CKGDRBDZZMZHJB-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.42 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|