C26H21BrN2O5S — CID 3945792
5-bromo-2-methoxy-N-[[2-methoxy-5-(2-oxochromen-3-yl)phenyl]carbamothioyl]-3-methylbenzamide (PubChem CID 3945792) has the molecular formula C26H21BrN2O5S and a molecular weight of 553.43 g/mol. Its IUPAC name is 5-bromo-2-methoxy-N-[[2-methoxy-5-(2-oxochromen-3-yl)phenyl]carbamothioyl]-3-methylbenzamide.
| Compound Name | 5-bromo-2-methoxy-N-[[2-methoxy-5-(2-oxochromen-3-yl)phenyl]carbamothioyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 3945792 |
| Molecular Formula | C26H21BrN2O5S |
| Molecular Weight | 553.43 g/mol |
| Exact Mass | 552.04 |
| IUPAC Name | 5-bromo-2-methoxy-N-[[2-methoxy-5-(2-oxochromen-3-yl)phenyl]carbamothioyl]-3-methylbenzamide |
| SMILES | COc1ccc(-c2cc3ccccc3oc2=O)cc1NC(=S)NC(=O)c1cc(Br)cc(C)c1OC |
| InChI | InChI=1S/C26H21BrN2O5S/c1-14-10-17(27)13-19(23(14)33-3)24(30)29-26(35)28-20-12-15(8-9-22(20)32-2)18-11-16-6-4-5-7-21(16)34-25(18)31/h4-13H,1-3H3,(H2,28,29,30,35) |
| InChIKey | BZGOMDGWNYGICZ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.43 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|