C25H20BrNO5 — CID 2219017
3-bromo-4-ethoxy-N-[2-methoxy-5-(2-oxochromen-3-yl)phenyl]benzamide (PubChem CID 2219017) has the molecular formula C25H20BrNO5 and a molecular weight of 494.34 g/mol. Its IUPAC name is 3-bromo-4-ethoxy-N-[2-methoxy-5-(2-oxochromen-3-yl)phenyl]benzamide.
| Compound Name | 3-bromo-4-ethoxy-N-[2-methoxy-5-(2-oxochromen-3-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 2219017 |
| Molecular Formula | C25H20BrNO5 |
| Molecular Weight | 494.34 g/mol |
| Exact Mass | 493.05 |
| IUPAC Name | 3-bromo-4-ethoxy-N-[2-methoxy-5-(2-oxochromen-3-yl)phenyl]benzamide |
| SMILES | CCOc1ccc(C(=O)Nc2cc(-c3cc4ccccc4oc3=O)ccc2OC)cc1Br |
| InChI | InChI=1S/C25H20BrNO5/c1-3-31-22-10-9-17(13-19(22)26)24(28)27-20-14-15(8-11-23(20)30-2)18-12-16-6-4-5-7-21(16)32-25(18)29/h4-14H,3H2,1-2H3,(H,27,28) |
| InChIKey | DXOYFMSWLWVRBC-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.34 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|