C30H20N2O5 — CID 4682019
N-[5-(1,3-benzoxazol-2-yl)-2-methoxyphenyl]-3-(2-oxochromen-3-yl)benzamide (PubChem CID 4682019) has the molecular formula C30H20N2O5 and a molecular weight of 488.50 g/mol. Its IUPAC name is N-[5-(1,3-benzoxazol-2-yl)-2-methoxyphenyl]-3-(2-oxochromen-3-yl)benzamide.
| Compound Name | N-[5-(1,3-benzoxazol-2-yl)-2-methoxyphenyl]-3-(2-oxochromen-3-yl)benzamide |
|---|---|
| PubChem CID | 4682019 |
| Molecular Formula | C30H20N2O5 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | N-[5-(1,3-benzoxazol-2-yl)-2-methoxyphenyl]-3-(2-oxochromen-3-yl)benzamide |
| SMILES | COc1ccc(-c2nc3ccccc3o2)cc1NC(=O)c1cccc(-c2cc3ccccc3oc2=O)c1 |
| InChI | InChI=1S/C30H20N2O5/c1-35-26-14-13-21(29-32-23-10-3-5-12-27(23)36-29)17-24(26)31-28(33)20-9-6-8-18(15-20)22-16-19-7-2-4-11-25(19)37-30(22)34/h2-17H,1H3,(H,31,33) |
| InChIKey | FTXLNLSOLHMNRE-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|